C23H26N4O4 — CID 67877425
ethyl 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-phenylpropanoate (PubChem CID 67877425) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67877425 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | ethyl 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)C1CC1C(=O)Nc1ccc(C=NN)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O4/c1-2-31-21(28)13-20(16-6-4-3-5-7-16)27-23(30)19-12-18(19)22(29)26-17-10-8-15(9-11-17)14-25-24/h3-11,14,18-20H,2,12-13,24H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | YZFDXRGIRGLYRW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|