C15H20N4O5 — CID 70061469
(3S)-4-hydroxy-3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]butanoic acid (PubChem CID 70061469) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3S)-4-hydroxy-3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | (3S)-4-hydroxy-3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70061469 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3S)-4-hydroxy-3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]butanoic acid |
| SMILES | NN=Cc1ccc(NC(=O)CCC(=O)N[C@H](CO)CC(=O)O)cc1 |
| InChI | InChI=1S/C15H20N4O5/c16-17-8-10-1-3-11(4-2-10)18-13(21)5-6-14(22)19-12(9-20)7-15(23)24/h1-4,8,12,20H,5-7,9,16H2,(H,18,21)(H,19,22)(H,23,24)/t12-/m0/s1 |
| InChIKey | UIPJYDXZIICCIL-LBPRGKRZSA-N |
| XLogP | -0.35 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|