C18H28N4O2 — CID 142639904
N'-(2,4-dimethylpentan-3-yl)-N-(4-methanehydrazonoylphenyl)butanediamide (PubChem CID 142639904) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N'-(2,4-dimethylpentan-3-yl)-N-(4-methanehydrazonoylphenyl)butanediamide.
| Compound Name | N'-(2,4-dimethylpentan-3-yl)-N-(4-methanehydrazonoylphenyl)butanediamide |
|---|---|
| PubChem CID | 142639904 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N'-(2,4-dimethylpentan-3-yl)-N-(4-methanehydrazonoylphenyl)butanediamide |
| SMILES | CC(C)C(NC(=O)CCC(=O)Nc1ccc(C=NN)cc1)C(C)C |
| InChI | InChI=1S/C18H28N4O2/c1-12(2)18(13(3)4)22-17(24)10-9-16(23)21-15-7-5-14(6-8-15)11-20-19/h5-8,11-13,18H,9-10,19H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | FDZMVNSSZBJOOK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|