C21H26N6O2 — CID 68508823
N,N'-bis(4-methanehydrazonoylphenyl)heptanediamide (PubChem CID 68508823) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N,N'-bis(4-methanehydrazonoylphenyl)heptanediamide.
| Compound Name | N,N'-bis(4-methanehydrazonoylphenyl)heptanediamide |
|---|---|
| PubChem CID | 68508823 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N,N'-bis(4-methanehydrazonoylphenyl)heptanediamide |
| SMILES | NN=Cc1ccc(NC(=O)CCCCCC(=O)Nc2ccc(C=NN)cc2)cc1 |
| InChI | InChI=1S/C21H26N6O2/c22-24-14-16-6-10-18(11-7-16)26-20(28)4-2-1-3-5-21(29)27-19-12-8-17(9-13-19)15-25-23/h6-15H,1-5,22-23H2,(H,26,28)(H,27,29) |
| InChIKey | OWBVXHRAPXIAGQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|