C17H22N4O4 — CID 70063052
3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]hex-5-enoic acid (PubChem CID 70063052) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]hex-5-enoic acid.
| Compound Name | 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]hex-5-enoic acid |
|---|---|
| PubChem CID | 70063052 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]hex-5-enoic acid |
| SMILES | C=CCC(CC(=O)O)NC(=O)CCC(=O)Nc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C17H22N4O4/c1-2-3-14(10-17(24)25)21-16(23)9-8-15(22)20-13-6-4-12(5-7-13)11-19-18/h2,4-7,11,14H,1,3,8-10,18H2,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | ADQBQXXHNVSIKL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|