C18H26N4O3 — CID 70074867
3-[4-(4-methanehydrazonoylphenyl)butylcarbamoylamino]hex-5-enoic acid (PubChem CID 70074867) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[4-(4-methanehydrazonoylphenyl)butylcarbamoylamino]hex-5-enoic acid.
| Compound Name | 3-[4-(4-methanehydrazonoylphenyl)butylcarbamoylamino]hex-5-enoic acid |
|---|---|
| PubChem CID | 70074867 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[4-(4-methanehydrazonoylphenyl)butylcarbamoylamino]hex-5-enoic acid |
| SMILES | C=CCC(CC(=O)O)NC(=O)NCCCCc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C18H26N4O3/c1-2-5-16(12-17(23)24)22-18(25)20-11-4-3-6-14-7-9-15(10-8-14)13-21-19/h2,7-10,13,16H,1,3-6,11-12,19H2,(H,23,24)(H2,20,22,25) |
| InChIKey | LICJSPAWHBCSMW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|