C29H33N3O4 — CID 70074078
ethyl 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoate (PubChem CID 70074078) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoate.
| Compound Name | ethyl 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 70074078 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | ethyl 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(Oc2ccccc2)c1)NC(=O)CCCCc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-2-35-29(34)27(20-24-10-8-13-26(19-24)36-25-11-4-3-5-12-25)32-28(33)14-7-6-9-22-15-17-23(18-16-22)21-31-30/h3-5,8,10-13,15-19,21,27H,2,6-7,9,14,20,30H2,1H3,(H,32,33) |
| InChIKey | QFQCGRNPYCBRGC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|