C24H28N4O3 — CID 70073723
ethyl 3-(4-cyanophenyl)-2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]propanoate (PubChem CID 70073723) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl 3-(4-cyanophenyl)-2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]propanoate.
| Compound Name | ethyl 3-(4-cyanophenyl)-2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 70073723 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl 3-(4-cyanophenyl)-2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C#N)cc1)NC(=O)CCCCc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-2-31-24(30)22(15-19-9-11-20(16-25)12-10-19)28-23(29)6-4-3-5-18-7-13-21(14-8-18)17-27-26/h7-14,17,22H,2-6,15,26H2,1H3,(H,28,29) |
| InChIKey | CKOOVIZICKARMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|