C27H29N3O4 — CID 67858747
2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoic acid (PubChem CID 67858747) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoic acid.
| Compound Name | 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 67858747 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[5-(4-methanehydrazonoylphenyl)pentanoylamino]-3-(3-phenoxyphenyl)propanoic acid |
| SMILES | NN=Cc1ccc(CCCCC(=O)NC(Cc2cccc(Oc3ccccc3)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H29N3O4/c28-29-19-21-15-13-20(14-16-21)7-4-5-12-26(31)30-25(27(32)33)18-22-8-6-11-24(17-22)34-23-9-2-1-3-10-23/h1-3,6,8-11,13-17,19,25H,4-5,7,12,18,28H2,(H,30,31)(H,32,33) |
| InChIKey | VRMANWQCLYNQAA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|