C38H35N5O4 — CID 69273788
N-[1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-4-methanehydrazonoyl-N-[(3-phenoxyphenyl)methyl]benzamide (PubChem CID 69273788) has the molecular formula C38H35N5O4 and a molecular weight of 625.73 g/mol. Its IUPAC name is N-[1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-4-methanehydrazonoyl-N-[(3-phenoxyphenyl)methyl]benzamide.
| Compound Name | N-[1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-4-methanehydrazonoyl-N-[(3-phenoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 69273788 |
| Molecular Formula | C38H35N5O4 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | N-[1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-4-methanehydrazonoyl-N-[(3-phenoxyphenyl)methyl]benzamide |
| SMILES | NN=Cc1ccc(C(=O)N(Cc2cccc(Oc3ccccc3)c2)C(Cc2ccc(-c3ccccc3)cc2)C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C38H35N5O4/c39-36(44)25-41-37(45)35(23-27-14-18-31(19-15-27)30-9-3-1-4-10-30)43(38(46)32-20-16-28(17-21-32)24-42-40)26-29-8-7-13-34(22-29)47-33-11-5-2-6-12-33/h1-22,24,35H,23,25-26,40H2,(H2,39,44)(H,41,45) |
| InChIKey | ISBZDPJJJWEUBY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|