C36H37NO7 — CID 71598431
carboxy 6-[3-[[[4-(3-phenoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate (PubChem CID 71598431) has the molecular formula C36H37NO7 and a molecular weight of 595.69 g/mol. Its IUPAC name is carboxy 6-[3-[[[4-(3-phenoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate.
| Compound Name | carboxy 6-[3-[[[4-(3-phenoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 71598431 |
| Molecular Formula | C36H37NO7 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | carboxy 6-[3-[[[4-(3-phenoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
| SMILES | CC(C)N(Cc1cccc(OCCCCCC(=O)OC(=O)O)c1)C(=O)c1ccc(-c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H37NO7/c1-26(2)37(25-27-11-9-15-32(23-27)42-22-8-4-7-17-34(38)44-36(40)41)35(39)29-20-18-28(19-21-29)30-12-10-16-33(24-30)43-31-13-5-3-6-14-31/h3,5-6,9-16,18-21,23-24,26H,4,7-8,17,22,25H2,1-2H3,(H,40,41) |
| InChIKey | QLIWAXCVJLKVRB-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|