C32H34N2O6 — CID 71597935
carboxy 6-[3-[[[4-(1H-indol-3-yl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate (PubChem CID 71597935) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is carboxy 6-[3-[[[4-(1H-indol-3-yl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate.
| Compound Name | carboxy 6-[3-[[[4-(1H-indol-3-yl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 71597935 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | carboxy 6-[3-[[[4-(1H-indol-3-yl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
| SMILES | CC(C)N(Cc1cccc(OCCCCCC(=O)OC(=O)O)c1)C(=O)c1ccc(-c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C32H34N2O6/c1-22(2)34(21-23-9-8-10-26(19-23)39-18-7-3-4-13-30(35)40-32(37)38)31(36)25-16-14-24(15-17-25)28-20-33-29-12-6-5-11-27(28)29/h5-6,8-12,14-17,19-20,22,33H,3-4,7,13,18,21H2,1-2H3,(H,37,38) |
| InChIKey | KZPYWTMXJHPYDV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|