C24H31NO5 — CID 86282642
6-[2-[[(4-methoxybenzoyl)-propan-2-ylamino]methyl]phenoxy]hexanoic acid (PubChem CID 86282642) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 6-[2-[[(4-methoxybenzoyl)-propan-2-ylamino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[(4-methoxybenzoyl)-propan-2-ylamino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 86282642 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 6-[2-[[(4-methoxybenzoyl)-propan-2-ylamino]methyl]phenoxy]hexanoic acid |
| SMILES | COc1ccc(C(=O)N(Cc2ccccc2OCCCCCC(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-18(2)25(24(28)19-12-14-21(29-3)15-13-19)17-20-9-6-7-10-22(20)30-16-8-4-5-11-23(26)27/h6-7,9-10,12-15,18H,4-5,8,11,16-17H2,1-3H3,(H,26,27) |
| InChIKey | IDFSBISIWACBMW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|