C23H27N3O5 — CID 121277073
5-[2-[[[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-propan-2-ylamino]methyl]phenoxy]pentanoic acid (PubChem CID 121277073) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-[2-[[[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-propan-2-ylamino]methyl]phenoxy]pentanoic acid.
| Compound Name | 5-[2-[[[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-propan-2-ylamino]methyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 121277073 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 5-[2-[[[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-propan-2-ylamino]methyl]phenoxy]pentanoic acid |
| SMILES | CC(C)N(Cc1ccccc1OCCCCC(=O)O)C(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C23H27N3O5/c1-16(2)26(23(29)19-14-18(24-25-19)21-10-7-13-31-21)15-17-8-3-4-9-20(17)30-12-6-5-11-22(27)28/h3-4,7-10,13-14,16H,5-6,11-12,15H2,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | OEQIWKUFPFCZSN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|