C25H29FN2O5 — CID 154594052
6-[2-[2-[4-fluoro-5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-3-methylbutyl]phenoxy]hexanoic acid (PubChem CID 154594052) has the molecular formula C25H29FN2O5 and a molecular weight of 456.51 g/mol. Its IUPAC name is 6-[2-[2-[4-fluoro-5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-3-methylbutyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[2-[4-fluoro-5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-3-methylbutyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 154594052 |
| Molecular Formula | C25H29FN2O5 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 6-[2-[2-[4-fluoro-5-(furan-2-yl)-1H-pyrazole-3-carbonyl]-3-methylbutyl]phenoxy]hexanoic acid |
| SMILES | CC(C)C(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1n[nH]c(-c2ccco2)c1F |
| InChI | InChI=1S/C25H29FN2O5/c1-16(2)18(25(31)24-22(26)23(27-28-24)20-11-8-14-33-20)15-17-9-5-6-10-19(17)32-13-7-3-4-12-21(29)30/h5-6,8-11,14,16,18H,3-4,7,12-13,15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | JOGSNGOOGPDILH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|