C25H29NO5S — CID 121270187
6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)thiophene-2-carbonyl]amino]methyl]phenoxy]hexanoic acid (PubChem CID 121270187) has the molecular formula C25H29NO5S and a molecular weight of 456.58 g/mol. Its IUPAC name is 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)thiophene-2-carbonyl]amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)thiophene-2-carbonyl]amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270187 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)thiophene-2-carbonyl]amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1ccc(-c2ccco2)s1 |
| InChI | InChI=1S/C25H29NO5S/c1-18(2)26(25(29)23-14-13-22(32-23)21-11-8-16-31-21)17-19-9-5-6-10-20(19)30-15-7-3-4-12-24(27)28/h5-6,8-11,13-14,16,18H,3-4,7,12,15,17H2,1-2H3,(H,27,28)/i18D |
| InChIKey | HPMZZTYZUSPXDZ-VAAKKRCDSA-N |
| XLogP | 6.08 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|