C28H34N2O5 — CID 121270288
ethyl 6-[2-[[2-deuteriopropan-2-yl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]methyl]phenoxy]hexanoate (PubChem CID 121270288) has the molecular formula C28H34N2O5 and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 6-[2-[[2-deuteriopropan-2-yl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]methyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[[2-deuteriopropan-2-yl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 121270288 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | ethyl 6-[2-[[2-deuteriopropan-2-yl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]methyl]phenoxy]hexanoate |
| SMILES | [2H]C(C)(C)N(Cc1ccccc1OCCCCCC(=O)OCC)C(=O)c1ccc(-c2ccco2)nc1 |
| InChI | InChI=1S/C28H34N2O5/c1-4-33-27(31)14-6-5-9-17-34-25-12-8-7-11-23(25)20-30(21(2)3)28(32)22-15-16-24(29-19-22)26-13-10-18-35-26/h7-8,10-13,15-16,18-19,21H,4-6,9,14,17,20H2,1-3H3/i21D |
| InChIKey | YQGIGRDUGNGNGJ-KRLANHAZSA-N |
| XLogP | 5.89 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|