C24H29N3O5 — CID 130304167
6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]amino]methyl]phenoxy]hexanoic acid (PubChem CID 130304167) has the molecular formula C24H29N3O5 and a molecular weight of 440.52 g/mol. Its IUPAC name is 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 130304167 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 6-[2-[[2-deuteriopropan-2-yl-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C24H29N3O5/c1-17(2)27(24(30)20-15-19(25-26-20)22-11-8-14-32-22)16-18-9-5-6-10-21(18)31-13-7-3-4-12-23(28)29/h5-6,8-11,14-15,17H,3-4,7,12-13,16H2,1-2H3,(H,25,26)(H,28,29)/i17D |
| InChIKey | LPGJWDOKKYYNIQ-OKWSDYJOSA-N |
| XLogP | 4.74 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|