C24H28N2O5S — CID 121270262
6-[[4-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-1,2-thiazol-3-yl]oxy]hexanoic acid (PubChem CID 121270262) has the molecular formula C24H28N2O5S and a molecular weight of 457.57 g/mol. Its IUPAC name is 6-[[4-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-1,2-thiazol-3-yl]oxy]hexanoic acid.
| Compound Name | 6-[[4-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-1,2-thiazol-3-yl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 121270262 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 6-[[4-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-1,2-thiazol-3-yl]oxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1csnc1OCCCCCC(=O)O)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-17(2)26(24(29)19-11-9-18(10-12-19)21-7-6-14-30-21)15-20-16-32-25-23(20)31-13-5-3-4-8-22(27)28/h6-7,9-12,14,16-17H,3-5,8,13,15H2,1-2H3,(H,27,28)/i17D |
| InChIKey | RAXOXQDXPCBSKD-OKWSDYJOSA-N |
| XLogP | 5.48 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|