C28H33NO5 — CID 121270723
6-[2-[dideuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-methylphenoxy]hexanoic acid (PubChem CID 121270723) has the molecular formula C28H33NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 6-[2-[dideuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-methylphenoxy]hexanoic acid.
| Compound Name | 6-[2-[dideuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-methylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270723 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 6-[2-[dideuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-methylphenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1cc(C)ccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccco2)cc1)C(C)C |
| InChI | InChI=1S/C28H33NO5/c1-20(2)29(28(32)23-13-11-22(12-14-23)25-8-7-17-34-25)19-24-18-21(3)10-15-26(24)33-16-6-4-5-9-27(30)31/h7-8,10-15,17-18,20H,4-6,9,16,19H2,1-3H3,(H,30,31)/i19D2 |
| InChIKey | SMLAHWIQISFNLS-FKUWIZNHSA-N |
| XLogP | 6.33 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|