C25H27NO5 — CID 123514212
6-[2-[[[4-(furan-2-yl)benzoyl]amino]methyl]-4-methylphenoxy]hexanoic acid (PubChem CID 123514212) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 6-[2-[[[4-(furan-2-yl)benzoyl]amino]methyl]-4-methylphenoxy]hexanoic acid.
| Compound Name | 6-[2-[[[4-(furan-2-yl)benzoyl]amino]methyl]-4-methylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 123514212 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 6-[2-[[[4-(furan-2-yl)benzoyl]amino]methyl]-4-methylphenoxy]hexanoic acid |
| SMILES | Cc1ccc(OCCCCCC(=O)O)c(CNC(=O)c2ccc(-c3ccco3)cc2)c1 |
| InChI | InChI=1S/C25H27NO5/c1-18-8-13-23(30-14-4-2-3-7-24(27)28)21(16-18)17-26-25(29)20-11-9-19(10-12-20)22-6-5-15-31-22/h5-6,8-13,15-16H,2-4,7,14,17H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | RBLOPSFSAYIPGS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|