C27H27NO4S — CID 121270091
6-[2-[deuterio-[4-[4-(furan-2-yl)phenyl]-2-methyl-1,3-thiazol-5-yl]methyl]phenoxy]hexanoic acid (PubChem CID 121270091) has the molecular formula C27H27NO4S and a molecular weight of 462.59 g/mol. Its IUPAC name is 6-[2-[deuterio-[4-[4-(furan-2-yl)phenyl]-2-methyl-1,3-thiazol-5-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[deuterio-[4-[4-(furan-2-yl)phenyl]-2-methyl-1,3-thiazol-5-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270091 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 6-[2-[deuterio-[4-[4-(furan-2-yl)phenyl]-2-methyl-1,3-thiazol-5-yl]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)c1sc(C)nc1-c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C27H27NO4S/c1-19-28-27(21-14-12-20(13-15-21)23-10-7-17-32-23)25(33-19)18-22-8-4-5-9-24(22)31-16-6-2-3-11-26(29)30/h4-5,7-10,12-15,17H,2-3,6,11,16,18H2,1H3,(H,29,30)/i18D |
| InChIKey | FUKDYPXSNLERHQ-VAAKKRCDSA-N |
| XLogP | 6.99 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|