C27H29NO5 — CID 121270379
6-[2-[cyclopropyl-[dideuterio-[4-(furan-2-yl)phenyl]methyl]carbamoyl]phenoxy]hexanoic acid (PubChem CID 121270379) has the molecular formula C27H29NO5 and a molecular weight of 449.54 g/mol. Its IUPAC name is 6-[2-[cyclopropyl-[dideuterio-[4-(furan-2-yl)phenyl]methyl]carbamoyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[cyclopropyl-[dideuterio-[4-(furan-2-yl)phenyl]methyl]carbamoyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270379 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-[2-[cyclopropyl-[dideuterio-[4-(furan-2-yl)phenyl]methyl]carbamoyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccc(-c2ccco2)cc1)N(C(=O)c1ccccc1OCCCCCC(=O)O)C1CC1 |
| InChI | InChI=1S/C27H29NO5/c29-26(30)10-2-1-5-17-33-25-8-4-3-7-23(25)27(31)28(22-15-16-22)19-20-11-13-21(14-12-20)24-9-6-18-32-24/h3-4,6-9,11-14,18,22H,1-2,5,10,15-17,19H2,(H,29,30)/i19D2 |
| InChIKey | JTWIMYNRKYUEEM-FKUWIZNHSA-N |
| XLogP | 5.78 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|