C25H27NO6 — CID 121270452
6-[2-[[cyclopropyl-[4-(furan-2-yl)furan-2-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270452) has the molecular formula C25H27NO6 and a molecular weight of 438.50 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-[4-(furan-2-yl)furan-2-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-[4-(furan-2-yl)furan-2-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270452 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 6-[2-[[cyclopropyl-[4-(furan-2-yl)furan-2-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1cc(-c2ccco2)co1)C1CC1 |
| InChI | InChI=1S/C25H27NO6/c27-24(28)10-2-1-5-13-30-21-8-4-3-7-18(21)16-26(20-11-12-20)25(29)23-15-19(17-32-23)22-9-6-14-31-22/h3-4,6-9,14-15,17,20H,1-2,5,10-13,16H2,(H,27,28)/i16D |
| InChIKey | KJLRNIBMDIJOLV-QNLPYAOMSA-N |
| XLogP | 5.37 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|