C30H34N2O4 — CID 121270909
6-[2-[[cyclopentyl-(4-pyridin-4-ylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270909) has the molecular formula C30H34N2O4 and a molecular weight of 487.62 g/mol. Its IUPAC name is 6-[2-[[cyclopentyl-(4-pyridin-4-ylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopentyl-(4-pyridin-4-ylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270909 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 6-[2-[[cyclopentyl-(4-pyridin-4-ylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccncc2)cc1)C1CCCC1 |
| InChI | InChI=1S/C30H34N2O4/c33-29(34)12-2-1-7-21-36-28-11-6-3-8-26(28)22-32(27-9-4-5-10-27)30(35)25-15-13-23(14-16-25)24-17-19-31-20-18-24/h3,6,8,11,13-20,27H,1-2,4-5,7,9-10,12,21-22H2,(H,33,34)/i22D |
| InChIKey | SPZFHYLHVKLDJC-JDANMYFYSA-N |
| XLogP | 6.36 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|