C33H33NO4 — CID 121270940
6-[2-[[benzyl-(4-phenylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270940) has the molecular formula C33H33NO4 and a molecular weight of 508.64 g/mol. Its IUPAC name is 6-[2-[[benzyl-(4-phenylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[benzyl-(4-phenylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270940 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 6-[2-[[benzyl-(4-phenylbenzoyl)amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(Cc1ccccc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33NO4/c35-32(36)18-8-3-11-23-38-31-17-10-9-16-30(31)25-34(24-26-12-4-1-5-13-26)33(37)29-21-19-28(20-22-29)27-14-6-2-7-15-27/h1-2,4-7,9-10,12-17,19-22H,3,8,11,18,23-25H2,(H,35,36)/i25D |
| InChIKey | NDSGAWQSMWSLKE-ZPJDWWTCSA-N |
| XLogP | 7.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|