C31H38N2O6 — CID 121270185
6-[2-[deuterio-[[4-(furan-3-yl)benzoyl]-(3-morpholin-4-ylpropyl)amino]methyl]phenoxy]hexanoic acid (PubChem CID 121270185) has the molecular formula C31H38N2O6 and a molecular weight of 535.66 g/mol. Its IUPAC name is 6-[2-[deuterio-[[4-(furan-3-yl)benzoyl]-(3-morpholin-4-ylpropyl)amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[deuterio-[[4-(furan-3-yl)benzoyl]-(3-morpholin-4-ylpropyl)amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270185 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 6-[2-[deuterio-[[4-(furan-3-yl)benzoyl]-(3-morpholin-4-ylpropyl)amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(CCCN1CCOCC1)C(=O)c1ccc(-c2ccoc2)cc1 |
| InChI | InChI=1S/C31H38N2O6/c34-30(35)9-2-1-5-19-39-29-8-4-3-7-27(29)23-33(16-6-15-32-17-21-37-22-18-32)31(36)26-12-10-25(11-13-26)28-14-20-38-24-28/h3-4,7-8,10-14,20,24H,1-2,5-6,9,15-19,21-23H2,(H,34,35)/i23D |
| InChIKey | BBUYSKLRYQBGCP-WBQFYUNPSA-N |
| XLogP | 5.34 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|