C30H35NO4 — CID 121270511
6-[2-[[butan-2-yl-(4-phenylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270511) has the molecular formula C30H35NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is 6-[2-[[butan-2-yl-(4-phenylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[butan-2-yl-(4-phenylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270511 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 6-[2-[[butan-2-yl-(4-phenylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccccc2)cc1)C(C)CC |
| InChI | InChI=1S/C30H35NO4/c1-3-23(2)31(30(34)26-19-17-25(18-20-26)24-12-6-4-7-13-24)22-27-14-9-10-15-28(27)35-21-11-5-8-16-29(32)33/h4,6-7,9-10,12-15,17-20,23H,3,5,8,11,16,21-22H2,1-2H3,(H,32,33)/i22D2 |
| InChIKey | UGCVNEVVPYBOLP-CVKSOVQJSA-N |
| XLogP | 6.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|