C30H33NO5 — CID 121270658
6-[2-[[cyclopropyl-[4-(2-methoxyphenyl)benzoyl]amino]-dideuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270658) has the molecular formula C30H33NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-[4-(2-methoxyphenyl)benzoyl]amino]-dideuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-[4-(2-methoxyphenyl)benzoyl]amino]-dideuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270658 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 6-[2-[[cyclopropyl-[4-(2-methoxyphenyl)benzoyl]amino]-dideuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccccc2OC)cc1)C1CC1 |
| InChI | InChI=1S/C30H33NO5/c1-35-28-12-7-5-10-26(28)22-14-16-23(17-15-22)30(34)31(25-18-19-25)21-24-9-4-6-11-27(24)36-20-8-2-3-13-29(32)33/h4-7,9-12,14-17,25H,2-3,8,13,18-21H2,1H3,(H,32,33)/i21D2 |
| InChIKey | WEZVFAXDDVCICL-GQZVJHRESA-N |
| XLogP | 6.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|