C27H29NO4S — CID 86281823
6-[2-[[cyclopropyl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid (PubChem CID 86281823) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 86281823 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 6-[2-[[cyclopropyl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1CN(C(=O)c1ccc(-c2ccsc2)cc1)C1CC1 |
| InChI | InChI=1S/C27H29NO4S/c29-26(30)8-2-1-5-16-32-25-7-4-3-6-22(25)18-28(24-13-14-24)27(31)21-11-9-20(10-12-21)23-15-17-33-19-23/h3-4,6-7,9-12,15,17,19,24H,1-2,5,8,13-14,16,18H2,(H,29,30) |
| InChIKey | MFZWZDFMLHHFIC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|