C32H35NO6S — CID 145061253
N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]-4-thiophen-3-ylbenzamide;formic acid (PubChem CID 145061253) has the molecular formula C32H35NO6S and a molecular weight of 561.70 g/mol. Its IUPAC name is N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]-4-thiophen-3-ylbenzamide;formic acid.
| Compound Name | N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]-4-thiophen-3-ylbenzamide;formic acid |
|---|---|
| PubChem CID | 145061253 |
| Molecular Formula | C32H35NO6S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]-4-thiophen-3-ylbenzamide;formic acid |
| SMILES | CCCCCCOc1ccccc1CN(C(=O)c1ccc(-c2ccsc2)cc1)C(O)(O)c1ccccc1.O=CO |
| InChI | InChI=1S/C31H33NO4S.CH2O2/c1-2-3-4-10-20-36-29-14-9-8-11-26(29)22-32(31(34,35)28-12-6-5-7-13-28)30(33)25-17-15-24(16-18-25)27-19-21-37-23-27;2-1-3/h5-9,11-19,21,23,34-35H,2-4,10,20,22H2,1H3;1H,(H,2,3) |
| InChIKey | HHUYNHNDHNNRJG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|