C32H34N2O3 — CID 145060870
N-[(2-hexoxyphenyl)methyl]-N-[hydroxy(phenyl)methyl]-4-pyridin-3-ylbenzamide (PubChem CID 145060870) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[(2-hexoxyphenyl)methyl]-N-[hydroxy(phenyl)methyl]-4-pyridin-3-ylbenzamide.
| Compound Name | N-[(2-hexoxyphenyl)methyl]-N-[hydroxy(phenyl)methyl]-4-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 145060870 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-[(2-hexoxyphenyl)methyl]-N-[hydroxy(phenyl)methyl]-4-pyridin-3-ylbenzamide |
| SMILES | CCCCCCOc1ccccc1CN(C(=O)c1ccc(-c2cccnc2)cc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C32H34N2O3/c1-2-3-4-10-22-37-30-16-9-8-14-29(30)24-34(31(35)26-12-6-5-7-13-26)32(36)27-19-17-25(18-20-27)28-15-11-21-33-23-28/h5-9,11-21,23,31,35H,2-4,10,22,24H2,1H3 |
| InChIKey | IPSYFNSYNOEFML-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|