C24H25N3O3 — CID 58858349
N'-(4-pentoxybenzoyl)-4-pyridin-3-ylbenzohydrazide (PubChem CID 58858349) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N'-(4-pentoxybenzoyl)-4-pyridin-3-ylbenzohydrazide.
| Compound Name | N'-(4-pentoxybenzoyl)-4-pyridin-3-ylbenzohydrazide |
|---|---|
| PubChem CID | 58858349 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N'-(4-pentoxybenzoyl)-4-pyridin-3-ylbenzohydrazide |
| SMILES | CCCCCOc1ccc(C(=O)NNC(=O)c2ccc(-c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-2-3-4-16-30-22-13-11-20(12-14-22)24(29)27-26-23(28)19-9-7-18(8-10-19)21-6-5-15-25-17-21/h5-15,17H,2-4,16H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | SZMJEBCYSPSAGL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|