C23H30N2O4 — CID 4935435
N'-[4-(2-methylpropoxy)benzoyl]-4-pentoxybenzohydrazide (PubChem CID 4935435) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N'-[4-(2-methylpropoxy)benzoyl]-4-pentoxybenzohydrazide.
| Compound Name | N'-[4-(2-methylpropoxy)benzoyl]-4-pentoxybenzohydrazide |
|---|---|
| PubChem CID | 4935435 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N'-[4-(2-methylpropoxy)benzoyl]-4-pentoxybenzohydrazide |
| SMILES | CCCCCOc1ccc(C(=O)NNC(=O)c2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-4-5-6-15-28-20-11-7-18(8-12-20)22(26)24-25-23(27)19-9-13-21(14-10-19)29-16-17(2)3/h7-14,17H,4-6,15-16H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | UVXGHESJLRMVFJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|