C33H35NO5 — CID 121270426
6-[2-[[2-deuteriopropan-2-yl-[4-[3-(furan-3-yl)phenyl]benzoyl]amino]methyl]phenoxy]hexanoic acid (PubChem CID 121270426) has the molecular formula C33H35NO5 and a molecular weight of 526.65 g/mol. Its IUPAC name is 6-[2-[[2-deuteriopropan-2-yl-[4-[3-(furan-3-yl)phenyl]benzoyl]amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[2-deuteriopropan-2-yl-[4-[3-(furan-3-yl)phenyl]benzoyl]amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270426 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 6-[2-[[2-deuteriopropan-2-yl-[4-[3-(furan-3-yl)phenyl]benzoyl]amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1ccc(-c2cccc(-c3ccoc3)c2)cc1 |
| InChI | InChI=1S/C33H35NO5/c1-24(2)34(22-29-9-5-6-12-31(29)39-19-7-3-4-13-32(35)36)33(37)26-16-14-25(15-17-26)27-10-8-11-28(21-27)30-18-20-38-23-30/h5-6,8-12,14-18,20-21,23-24H,3-4,7,13,19,22H2,1-2H3,(H,35,36)/i24D |
| InChIKey | QRWICPVKKASCFO-CORJAIEOSA-N |
| XLogP | 7.69 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|