C32H33NO5 — CID 157080664
N-benzyl-N-[dideuterio-[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-(furan-3-yl)benzamide (PubChem CID 157080664) has the molecular formula C32H33NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is N-benzyl-N-[dideuterio-[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-(furan-3-yl)benzamide.
| Compound Name | N-benzyl-N-[dideuterio-[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-(furan-3-yl)benzamide |
|---|---|
| PubChem CID | 157080664 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-benzyl-N-[dideuterio-[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-(furan-3-yl)benzamide |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)CO)N(Cc1ccccc1)C(=O)c1ccc(-c2ccoc2)cc1 |
| InChI | InChI=1S/C32H33NO5/c34-23-30(35)12-5-2-8-19-38-31-13-7-6-11-28(31)22-33(21-25-9-3-1-4-10-25)32(36)27-16-14-26(15-17-27)29-18-20-37-24-29/h1,3-4,6-7,9-11,13-18,20,24,34H,2,5,8,12,19,21-23H2/i22D2 |
| InChIKey | PPQDEZZQFYHYBF-CVKSOVQJSA-N |
| XLogP | 6.29 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|