C31H32N2O5 — CID 121270600
N-[dideuterio(phenyl)methyl]-4-(furan-2-yl)-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]benzamide (PubChem CID 121270600) has the molecular formula C31H32N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[dideuterio(phenyl)methyl]-4-(furan-2-yl)-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]benzamide.
| Compound Name | N-[dideuterio(phenyl)methyl]-4-(furan-2-yl)-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 121270600 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-[dideuterio(phenyl)methyl]-4-(furan-2-yl)-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]benzamide |
| SMILES | [2H]C([2H])(c1ccccc1)N(Cc1ccccc1OCCCCCC(=O)NO)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C31H32N2O5/c34-30(32-36)15-5-2-8-20-37-29-13-7-6-12-27(29)23-33(22-24-10-3-1-4-11-24)31(35)26-18-16-25(17-19-26)28-14-9-21-38-28/h1,3-4,6-7,9-14,16-19,21,36H,2,5,8,15,20,22-23H2,(H,32,34)/i22D2 |
| InChIKey | FTVZFAAUHDWUTJ-CVKSOVQJSA-N |
| XLogP | 6.23 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|