C32H33N3O4 — CID 140890704
N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-pyridin-4-ylbenzamide (PubChem CID 140890704) has the molecular formula C32H33N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-pyridin-4-ylbenzamide.
| Compound Name | N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 140890704 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-pyridin-4-ylbenzamide |
| SMILES | [2H]C([2H])(c1ccccc1)N(Cc1ccccc1OCCCCCC(=O)NO)C(=O)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C32H33N3O4/c36-31(34-38)13-5-2-8-22-39-30-12-7-6-11-29(30)24-35(23-25-9-3-1-4-10-25)32(37)28-16-14-26(15-17-28)27-18-20-33-21-19-27/h1,3-4,6-7,9-12,14-21,38H,2,5,8,13,22-24H2,(H,34,36)/i23D2 |
| InChIKey | ZPPDKBAKGNRURJ-RVWBZSOGSA-N |
| XLogP | 6.04 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|