C31H32N2O4S — CID 121270636
6-[2-[[(1,1-dideuterio-2-pyridin-2-ylethyl)-(4-thiophen-2-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid (PubChem CID 121270636) has the molecular formula C31H32N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is 6-[2-[[(1,1-dideuterio-2-pyridin-2-ylethyl)-(4-thiophen-2-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[(1,1-dideuterio-2-pyridin-2-ylethyl)-(4-thiophen-2-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270636 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 6-[2-[[(1,1-dideuterio-2-pyridin-2-ylethyl)-(4-thiophen-2-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(Cc1ccccn1)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C31H32N2O4S/c34-30(35)13-2-1-7-21-37-28-11-4-3-9-26(28)23-33(20-18-27-10-5-6-19-32-27)31(36)25-16-14-24(15-17-25)29-12-8-22-38-29/h3-6,8-12,14-17,19,22H,1-2,7,13,18,20-21,23H2,(H,34,35)/i20D2 |
| InChIKey | HXTUPSBZRLBAOV-FCLBBQIASA-N |
| XLogP | 6.72 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|