C27H29NO6S — CID 145060815
6-[2-[[cyclopropyl-(4-thiophen-2-ylbenzoyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid (PubChem CID 145060815) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-(4-thiophen-2-ylbenzoyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-(4-thiophen-2-ylbenzoyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145060815 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 6-[2-[[cyclopropyl-(4-thiophen-2-ylbenzoyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1C(O)(O)N(C(=O)c1ccc(-c2cccs2)cc1)C1CC1 |
| InChI | InChI=1S/C27H29NO6S/c29-25(30)10-2-1-5-17-34-23-8-4-3-7-22(23)27(32,33)28(21-15-16-21)26(31)20-13-11-19(12-14-20)24-9-6-18-35-24/h3-4,6-9,11-14,18,21,32-33H,1-2,5,10,15-17H2,(H,29,30) |
| InChIKey | VOLWSATXGIAXLL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|