C29H32FNO4 — CID 145060429
N-cyclopropyl-4-(4-fluorophenyl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]benzamide (PubChem CID 145060429) has the molecular formula C29H32FNO4 and a molecular weight of 477.58 g/mol. Its IUPAC name is N-cyclopropyl-4-(4-fluorophenyl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]benzamide.
| Compound Name | N-cyclopropyl-4-(4-fluorophenyl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]benzamide |
|---|---|
| PubChem CID | 145060429 |
| Molecular Formula | C29H32FNO4 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-cyclopropyl-4-(4-fluorophenyl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]benzamide |
| SMILES | CCCCCCOc1ccccc1C(O)(O)N(C(=O)c1ccc(-c2ccc(F)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C29H32FNO4/c1-2-3-4-7-20-35-27-9-6-5-8-26(27)29(33,34)31(25-18-19-25)28(32)23-12-10-21(11-13-23)22-14-16-24(30)17-15-22/h5-6,8-17,25,33-34H,2-4,7,18-20H2,1H3 |
| InChIKey | IFCIFGDDOFOOQG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|