C31H37NO5 — CID 145060536
N-cyclopropyl-N-[(2-hexoxyphenyl)-hydroxymethyl]-4-(2-methylphenyl)benzamide;formic acid (PubChem CID 145060536) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-hexoxyphenyl)-hydroxymethyl]-4-(2-methylphenyl)benzamide;formic acid.
| Compound Name | N-cyclopropyl-N-[(2-hexoxyphenyl)-hydroxymethyl]-4-(2-methylphenyl)benzamide;formic acid |
|---|---|
| PubChem CID | 145060536 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | N-cyclopropyl-N-[(2-hexoxyphenyl)-hydroxymethyl]-4-(2-methylphenyl)benzamide;formic acid |
| SMILES | CCCCCCOc1ccccc1C(O)N(C(=O)c1ccc(-c2ccccc2C)cc1)C1CC1.O=CO |
| InChI | InChI=1S/C30H35NO3.CH2O2/c1-3-4-5-10-21-34-28-14-9-8-13-27(28)30(33)31(25-19-20-25)29(32)24-17-15-23(16-18-24)26-12-7-6-11-22(26)2;2-1-3/h6-9,11-18,25,30,33H,3-5,10,19-21H2,1-2H3;1H,(H,2,3) |
| InChIKey | DAZHHBYCFPEGNF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|