C29H30FNO5 — CID 145061088
6-[2-[[cyclopropyl-[4-(2-fluorophenyl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid (PubChem CID 145061088) has the molecular formula C29H30FNO5 and a molecular weight of 491.56 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-[4-(2-fluorophenyl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-[4-(2-fluorophenyl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145061088 |
| Molecular Formula | C29H30FNO5 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 6-[2-[[cyclopropyl-[4-(2-fluorophenyl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1C(O)N(C(=O)c1ccc(-c2ccccc2F)cc1)C1CC1 |
| InChI | InChI=1S/C29H30FNO5/c30-25-10-5-3-8-23(25)20-13-15-21(16-14-20)28(34)31(22-17-18-22)29(35)24-9-4-6-11-26(24)36-19-7-1-2-12-27(32)33/h3-6,8-11,13-16,22,29,35H,1-2,7,12,17-19H2,(H,32,33) |
| InChIKey | HGMVZMCGQVVJBF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|