C27H29NO6 — CID 145060902
6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid (PubChem CID 145060902) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145060902 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-hydroxymethyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1C(O)N(C(=O)c1ccc(-c2ccco2)cc1)C1CC1 |
| InChI | InChI=1S/C27H29NO6/c29-25(30)10-2-1-5-17-34-24-8-4-3-7-22(24)27(32)28(21-15-16-21)26(31)20-13-11-19(12-14-20)23-9-6-18-33-23/h3-4,6-9,11-14,18,21,27,32H,1-2,5,10,15-17H2,(H,29,30) |
| InChIKey | SNGKLLIGDFWOTR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|