C25H29NO6 — CID 145060661
4-(furan-2-yl)benzaldehyde;6-[2-[hydroxy(methylamino)methyl]phenoxy]hexanoic acid (PubChem CID 145060661) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 4-(furan-2-yl)benzaldehyde;6-[2-[hydroxy(methylamino)methyl]phenoxy]hexanoic acid.
| Compound Name | 4-(furan-2-yl)benzaldehyde;6-[2-[hydroxy(methylamino)methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145060661 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-(furan-2-yl)benzaldehyde;6-[2-[hydroxy(methylamino)methyl]phenoxy]hexanoic acid |
| SMILES | CNC(O)c1ccccc1OCCCCCC(=O)O.O=Cc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C14H21NO4.C11H8O2/c1-15-14(18)11-7-4-5-8-12(11)19-10-6-2-3-9-13(16)17;12-8-9-3-5-10(6-4-9)11-2-1-7-13-11/h4-5,7-8,14-15,18H,2-3,6,9-10H2,1H3,(H,16,17);1-8H |
| InChIKey | XPGQUBRSZRJTDF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|