C31H32N2O6 — CID 145060725
6-[2-[[[4-(furan-2-yl)benzoyl]-(2-pyridin-2-ylethyl)amino]-hydroxymethyl]phenoxy]hexanoic acid (PubChem CID 145060725) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is 6-[2-[[[4-(furan-2-yl)benzoyl]-(2-pyridin-2-ylethyl)amino]-hydroxymethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[[4-(furan-2-yl)benzoyl]-(2-pyridin-2-ylethyl)amino]-hydroxymethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145060725 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 6-[2-[[[4-(furan-2-yl)benzoyl]-(2-pyridin-2-ylethyl)amino]-hydroxymethyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1C(O)N(CCc1ccccn1)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C31H32N2O6/c34-29(35)13-2-1-7-21-39-28-11-4-3-10-26(28)31(37)33(20-18-25-9-5-6-19-32-25)30(36)24-16-14-23(15-17-24)27-12-8-22-38-27/h3-6,8-12,14-17,19,22,31,37H,1-2,7,13,18,20-21H2,(H,34,35) |
| InChIKey | PGPMMKFGKYAHER-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|