C24H26N2O5 — CID 121270272
6-[[3-[dideuterio-[[4-(furan-2-yl)benzoyl]-methylamino]methyl]-2-pyridinyl]oxy]hexanoic acid (PubChem CID 121270272) has the molecular formula C24H26N2O5 and a molecular weight of 424.49 g/mol. Its IUPAC name is 6-[[3-[dideuterio-[[4-(furan-2-yl)benzoyl]-methylamino]methyl]-2-pyridinyl]oxy]hexanoic acid.
| Compound Name | 6-[[3-[dideuterio-[[4-(furan-2-yl)benzoyl]-methylamino]methyl]-2-pyridinyl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 121270272 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 6-[[3-[dideuterio-[[4-(furan-2-yl)benzoyl]-methylamino]methyl]-2-pyridinyl]oxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1cccnc1OCCCCCC(=O)O)N(C)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-26(24(29)19-12-10-18(11-13-19)21-8-6-16-30-21)17-20-7-5-14-25-23(20)31-15-4-2-3-9-22(27)28/h5-8,10-14,16H,2-4,9,15,17H2,1H3,(H,27,28)/i17D2 |
| InChIKey | VNOFXEOIOHLTLX-FBCWWBABSA-N |
| XLogP | 4.64 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|