C28H31NO5 — CID 121270679
6-[2-[[cyclopropylmethyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270679) has the molecular formula C28H31NO5 and a molecular weight of 462.56 g/mol. Its IUPAC name is 6-[2-[[cyclopropylmethyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropylmethyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270679 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 6-[2-[[cyclopropylmethyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(CC1CC1)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C28H31NO5/c30-27(31)10-2-1-5-17-33-26-8-4-3-7-24(26)20-29(19-21-11-12-21)28(32)23-15-13-22(14-16-23)25-9-6-18-34-25/h3-4,6-9,13-16,18,21H,1-2,5,10-12,17,19-20H2,(H,30,31)/i20D |
| InChIKey | DEYHYFOAWQOTFV-YVHRXSIGSA-N |
| XLogP | 6.02 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|