C27H28NNaO5 — CID 121270157
sodium 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoate (PubChem CID 121270157) has the molecular formula C27H28NNaO5 and a molecular weight of 470.52 g/mol. Its IUPAC name is sodium 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoate.
| Compound Name | sodium 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 121270157 |
| Molecular Formula | C27H28NNaO5 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | sodium 6-[2-[[cyclopropyl-[4-(furan-2-yl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoate |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)[O-])N(C(=O)c1ccc(-c2ccco2)cc1)C1CC1.[Na+] |
| InChI | InChI=1S/C27H29NO5.Na/c29-26(30)10-2-1-5-17-32-25-8-4-3-7-22(25)19-28(23-15-16-23)27(31)21-13-11-20(12-14-21)24-9-6-18-33-24;/h3-4,6-9,11-14,18,23H,1-2,5,10,15-17,19H2,(H,29,30);/q;+1/p-1/i19D; |
| InChIKey | CEVYGFHGCPGYQL-RFQPRQNUSA-M |
| XLogP | 1.44 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|