C30H33N3O4 — CID 121270807
N-cyclopropyl-N-[dideuterio-[2-[5-(2-methyl-5-oxo-1H-pyrazol-3-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide (PubChem CID 121270807) has the molecular formula C30H33N3O4 and a molecular weight of 501.62 g/mol. Its IUPAC name is N-cyclopropyl-N-[dideuterio-[2-[5-(2-methyl-5-oxo-1H-pyrazol-3-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide.
| Compound Name | N-cyclopropyl-N-[dideuterio-[2-[5-(2-methyl-5-oxo-1H-pyrazol-3-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide |
|---|---|
| PubChem CID | 121270807 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-cyclopropyl-N-[dideuterio-[2-[5-(2-methyl-5-oxo-1H-pyrazol-3-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCc1cc(=O)[nH]n1C)N(C(=O)c1ccc(-c2ccco2)cc1)C1CC1 |
| InChI | InChI=1S/C30H33N3O4/c1-32-26(20-29(34)31-32)9-3-2-6-18-36-28-10-5-4-8-24(28)21-33(25-16-17-25)30(35)23-14-12-22(13-15-23)27-11-7-19-37-27/h4-5,7-8,10-15,19-20,25H,2-3,6,9,16-18,21H2,1H3,(H,31,34)/i21D2 |
| InChIKey | VKJTXCKVYCIQOP-GQZVJHRESA-N |
| XLogP | 5.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|